C23H21N3 — CID 144765722
acetylene;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4,6-dipyridin-4-ylpyridine (PubChem CID 144765722) has the molecular formula C23H21N3 and a molecular weight of 339.44 g/mol. Its IUPAC name is acetylene;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4,6-dipyridin-4-ylpyridine.
| Compound Name | acetylene;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4,6-dipyridin-4-ylpyridine |
|---|---|
| PubChem CID | 144765722 |
| Molecular Formula | C23H21N3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | acetylene;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4,6-dipyridin-4-ylpyridine |
| SMILES | C#C.C/C=C\C(=C/C)c1cc(-c2ccncc2)cc(-c2ccncc2)n1 |
| InChI | InChI=1S/C21H19N3.C2H2/c1-3-5-16(4-2)20-14-19(17-6-10-22-11-7-17)15-21(24-20)18-8-12-23-13-9-18;1-2/h3-15H,1-2H3;1-2H/b5-3-,16-4+; |
| InChIKey | VOONWOIJOHJNCR-SDGYGWKMSA-N |
| XLogP | 5.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|