C17H19N3 — CID 144834762
3-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-5-pyridin-4-ylaniline (PubChem CID 144834762) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-5-pyridin-4-ylaniline.
| Compound Name | 3-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-5-pyridin-4-ylaniline |
|---|---|
| PubChem CID | 144834762 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-5-pyridin-4-ylaniline |
| SMILES | C/C=C(\C=C/NC)c1cc(N)cc(-c2ccncc2)c1 |
| InChI | InChI=1S/C17H19N3/c1-3-13(4-7-19-2)15-10-16(12-17(18)11-15)14-5-8-20-9-6-14/h3-12,19H,18H2,1-2H3/b7-4-,13-3+ |
| InChIKey | BBIIPNKVNLGZJC-TXPQKOLZSA-N |
| XLogP | 3.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|