C15H21N — CID 144774592
4,4,5-trimethyl-1-(4-methylphenyl)-2,3-dihydropyridine (PubChem CID 144774592) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 4,4,5-trimethyl-1-(4-methylphenyl)-2,3-dihydropyridine.
| Compound Name | 4,4,5-trimethyl-1-(4-methylphenyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 144774592 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 4,4,5-trimethyl-1-(4-methylphenyl)-2,3-dihydropyridine |
| SMILES | CC1=CN(c2ccc(C)cc2)CCC1(C)C |
| InChI | InChI=1S/C15H21N/c1-12-5-7-14(8-6-12)16-10-9-15(3,4)13(2)11-16/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | ZGNGRCIBAINUMZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|