C13H23ClN2O3S2 — CID 144774902
5-[[tert-butyl-methyl-(methylamino)-λ4-sulfanyl]oxymethyl]-2-chlorobenzenesulfonamide (PubChem CID 144774902) has the molecular formula C13H23ClN2O3S2 and a molecular weight of 354.93 g/mol. Its IUPAC name is 5-[[tert-butyl-methyl-(methylamino)-λ4-sulfanyl]oxymethyl]-2-chlorobenzenesulfonamide.
| Compound Name | 5-[[tert-butyl-methyl-(methylamino)-λ4-sulfanyl]oxymethyl]-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 144774902 |
| Molecular Formula | C13H23ClN2O3S2 |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 5-[[tert-butyl-methyl-(methylamino)-λ4-sulfanyl]oxymethyl]-2-chlorobenzenesulfonamide |
| SMILES | CNS(C)(OCc1ccc(Cl)c(S(N)(=O)=O)c1)C(C)(C)C |
| InChI | InChI=1S/C13H23ClN2O3S2/c1-13(2,3)20(5,16-4)19-9-10-6-7-11(14)12(8-10)21(15,17)18/h6-8,16H,9H2,1-5H3,(H2,15,17,18) |
| InChIKey | NOIMIIXYTXGMGD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |