C22H30NO4P — CID 144801539
[[2-(2-ethoxyethoxy)ethylamino]-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 144801539) has the molecular formula C22H30NO4P and a molecular weight of 403.46 g/mol. Its IUPAC name is [[2-(2-ethoxyethoxy)ethylamino]-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [[2-(2-ethoxyethoxy)ethylamino]-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 144801539 |
| Molecular Formula | C22H30NO4P |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [[2-(2-ethoxyethoxy)ethylamino]-phenylphosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCOCCOCCNP(=O)(C(=O)c1c(C)cc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C22H30NO4P/c1-5-26-13-14-27-12-11-23-28(25,20-9-7-6-8-10-20)22(24)21-18(3)15-17(2)16-19(21)4/h6-10,15-16H,5,11-14H2,1-4H3,(H,23,25) |
| InChIKey | LUSWTOXZJVNUEA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|