C12H21N — CID 144802636
(3Z)-N-tert-butyl-5-methylidenehepta-1,3-dien-2-amine (PubChem CID 144802636) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3Z)-N-tert-butyl-5-methylidenehepta-1,3-dien-2-amine.
| Compound Name | (3Z)-N-tert-butyl-5-methylidenehepta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 144802636 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3Z)-N-tert-butyl-5-methylidenehepta-1,3-dien-2-amine |
| SMILES | C=C(/C=C\C(=C)NC(C)(C)C)CC |
| InChI | InChI=1S/C12H21N/c1-7-10(2)8-9-11(3)13-12(4,5)6/h8-9,13H,2-3,7H2,1,4-6H3/b9-8- |
| InChIKey | DVOMYPCDBBJKIZ-HJWRWDBZSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|