C17H33NO3 — CID 144811971
tert-butyl N-[2-[(4Z)-2-methylhepta-2,4-dien-3-yl]oxyethyl]carbamate;ethane (PubChem CID 144811971) has the molecular formula C17H33NO3 and a molecular weight of 299.45 g/mol. Its IUPAC name is tert-butyl N-[2-[(4Z)-2-methylhepta-2,4-dien-3-yl]oxyethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-[(4Z)-2-methylhepta-2,4-dien-3-yl]oxyethyl]carbamate;ethane |
|---|---|
| PubChem CID | 144811971 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | tert-butyl N-[2-[(4Z)-2-methylhepta-2,4-dien-3-yl]oxyethyl]carbamate;ethane |
| SMILES | CC.CC/C=C\C(OCCNC(=O)OC(C)(C)C)=C(C)C |
| InChI | InChI=1S/C15H27NO3.C2H6/c1-7-8-9-13(12(2)3)18-11-10-16-14(17)19-15(4,5)6;1-2/h8-9H,7,10-11H2,1-6H3,(H,16,17);1-2H3/b9-8-; |
| InChIKey | NJPGVSSZGNNNCQ-UOQXYWCXSA-N |
| XLogP | 4.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|