C29H31ClF2O6 — CID 144812984
(2S,4S,6R)-6-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]cyclohexa-2,4-dien-1-yl]-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxyoxane-2-carbaldehyde (PubChem CID 144812984) has the molecular formula C29H31ClF2O6 and a molecular weight of 549.01 g/mol. Its IUPAC name is (2S,4S,6R)-6-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]cyclohexa-2,4-dien-1-yl]-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxyoxane-2-carbaldehyde.
| Compound Name | (2S,4S,6R)-6-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]cyclohexa-2,4-dien-1-yl]-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 144812984 |
| Molecular Formula | C29H31ClF2O6 |
| Molecular Weight | 549.01 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | (2S,4S,6R)-6-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]cyclohexa-2,4-dien-1-yl]-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxyoxane-2-carbaldehyde |
| SMILES | COc1ccc(CC2=CC([C@@]3(OC)C[C@@H](OCc4ccccc4)C[C@@](C=O)(CO)O3)CC=C2Cl)c(F)c1F |
| InChI | InChI=1S/C29H31ClF2O6/c1-35-25-11-8-20(26(31)27(25)32)12-21-13-22(9-10-24(21)30)29(36-2)15-23(14-28(17-33,18-34)38-29)37-16-19-6-4-3-5-7-19/h3-8,10-11,13,17,22-23,34H,9,12,14-16,18H2,1-2H3/t22?,23-,28+,29+/m0/s1 |
| InChIKey | VOKPIINCYVFYSW-DIFGGTTFSA-N |
| XLogP | 5.25 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.01 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|