C29H34FN3O — CID 144813118
N-[1-[7-ethyl-4-fluoro-1-[[4-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]methyl]indol-3-yl]ethenyl]oxan-4-amine (PubChem CID 144813118) has the molecular formula C29H34FN3O and a molecular weight of 459.61 g/mol. Its IUPAC name is N-[1-[7-ethyl-4-fluoro-1-[[4-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]methyl]indol-3-yl]ethenyl]oxan-4-amine.
| Compound Name | N-[1-[7-ethyl-4-fluoro-1-[[4-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]methyl]indol-3-yl]ethenyl]oxan-4-amine |
|---|---|
| PubChem CID | 144813118 |
| Molecular Formula | C29H34FN3O |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | N-[1-[7-ethyl-4-fluoro-1-[[4-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]methyl]indol-3-yl]ethenyl]oxan-4-amine |
| SMILES | C=C(NC1CCOCC1)c1cn(Cc2ccc(C(=C/C)/C=N/C)cc2)c2c(CC)ccc(F)c12 |
| InChI | InChI=1S/C29H34FN3O/c1-5-22-11-12-27(30)28-26(20(3)32-25-13-15-34-16-14-25)19-33(29(22)28)18-21-7-9-24(10-8-21)23(6-2)17-31-4/h6-12,17,19,25,32H,3,5,13-16,18H2,1-2,4H3/b23-6+,31-17+ |
| InChIKey | VJODUGRWVJDFFM-QBGKPIROSA-N |
| XLogP | 6.23 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|