C24H30N6O7PS+ — CID 144828841
[(2S)-2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-1-propan-2-yloxypropylidene]oxidanium (PubChem CID 144828841) has the molecular formula C24H30N6O7PS+ and a molecular weight of 577.58 g/mol. Its IUPAC name is [(2S)-2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-1-propan-2-yloxypropylidene]oxidanium.
| Compound Name | [(2S)-2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-1-propan-2-yloxypropylidene]oxidanium |
|---|---|
| PubChem CID | 144828841 |
| Molecular Formula | C24H30N6O7PS+ |
| Molecular Weight | 577.58 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | [(2S)-2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-1-propan-2-yloxypropylidene]oxidanium |
| SMILES | [H]/[O+]=C(\OC(C)C)[C@H](C)NP(=S)(OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@](O)(C#C)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H29N6O7PS/c1-5-24(33)19(31)17(36-23(24)30-13-28-18-20(25)26-12-27-21(18)30)11-34-38(39,37-16-9-7-6-8-10-16)29-15(4)22(32)35-14(2)3/h1,6-10,12-15,17,19,23,31,33H,11H2,2-4H3,(H,29,39)(H2,25,26,27)/p+1/t15-,17+,19+,23+,24+,38?/m0/s1 |
| InChIKey | HOSKJXDYYJKTRD-ZAZWKDECSA-O |
| XLogP | 1.26 |
| TPSA | 180.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.58 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|