C22H35NO2 — CID 144829959
N-ethyl-N-[[(3Z,5E,7E,10E)-7-methoxy-5-methyl-4-prop-1-en-2-yl-1-oxacycloundeca-3,5,7,10-tetraen-3-yl]methyl]butan-1-amine (PubChem CID 144829959) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is N-ethyl-N-[[(3Z,5E,7E,10E)-7-methoxy-5-methyl-4-prop-1-en-2-yl-1-oxacycloundeca-3,5,7,10-tetraen-3-yl]methyl]butan-1-amine.
| Compound Name | N-ethyl-N-[[(3Z,5E,7E,10E)-7-methoxy-5-methyl-4-prop-1-en-2-yl-1-oxacycloundeca-3,5,7,10-tetraen-3-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 144829959 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | N-ethyl-N-[[(3Z,5E,7E,10E)-7-methoxy-5-methyl-4-prop-1-en-2-yl-1-oxacycloundeca-3,5,7,10-tetraen-3-yl]methyl]butan-1-amine |
| SMILES | C=C(C)C1=C(\CN(CC)CCCC)CO/C=C/C/C=C(OC)/C=C\1C |
| InChI | InChI=1S/C22H35NO2/c1-7-9-13-23(8-2)16-20-17-25-14-11-10-12-21(24-6)15-19(5)22(20)18(3)4/h11-12,14-15H,3,7-10,13,16-17H2,1-2,4-6H3/b14-11+,19-15+,21-12+,22-20- |
| InChIKey | MMCBACXZLLOGPW-HJBZYSOVSA-N |
| XLogP | 5.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |