C41H42BN5O2 — CID 144830941
N-benzylmethanimine;N-methylidene-N'-[(N-[4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]anilino)methyl]methanimidamide (PubChem CID 144830941) has the molecular formula C41H42BN5O2 and a molecular weight of 647.63 g/mol. Its IUPAC name is N-benzylmethanimine;N-methylidene-N'-[(N-[4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]anilino)methyl]methanimidamide.
| Compound Name | N-benzylmethanimine;N-methylidene-N'-[(N-[4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]anilino)methyl]methanimidamide |
|---|---|
| PubChem CID | 144830941 |
| Molecular Formula | C41H42BN5O2 |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | N-benzylmethanimine;N-methylidene-N'-[(N-[4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]anilino)methyl]methanimidamide |
| SMILES | C=N/C=N\CN(c1ccccc1)c1ccc(-n2c3ccccc3c3ccc(B4OC(C)(C)C(C)(C)O4)cc32)cc1.C=NCc1ccccc1 |
| InChI | InChI=1S/C33H33BN4O2.C8H9N/c1-32(2)33(3,4)40-34(39-32)24-15-20-29-28-13-9-10-14-30(28)38(31(29)21-24)27-18-16-26(17-19-27)37(23-36-22-35-5)25-11-7-6-8-12-25;1-9-7-8-5-3-2-4-6-8/h6-22H,5,23H2,1-4H3;2-6H,1,7H2/b36-22-; |
| InChIKey | KOOOTPKIOZPOIA-DRJYANIXSA-N |
| XLogP | 8.79 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|