C11H22N2O — CID 144840242
(2E,4E)-3-methyl-5-[methyl-[2-(methylamino)ethyl]amino]hexa-2,4-dien-2-ol (PubChem CID 144840242) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-[methyl-[2-(methylamino)ethyl]amino]hexa-2,4-dien-2-ol.
| Compound Name | (2E,4E)-3-methyl-5-[methyl-[2-(methylamino)ethyl]amino]hexa-2,4-dien-2-ol |
|---|---|
| PubChem CID | 144840242 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (2E,4E)-3-methyl-5-[methyl-[2-(methylamino)ethyl]amino]hexa-2,4-dien-2-ol |
| SMILES | CNCCN(C)/C(C)=C/C(C)=C(\C)O |
| InChI | InChI=1S/C11H22N2O/c1-9(11(3)14)8-10(2)13(5)7-6-12-4/h8,12,14H,6-7H2,1-5H3/b10-8+,11-9+ |
| InChIKey | DLOBYGCVXPIRGI-GFULKKFKSA-N |
| XLogP | 1.89 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|