C10H16N2O — CID 166065421
cyclopenta-2,4-dien-1-ylidene-[2-(dimethylamino)ethylamino]methanol (PubChem CID 166065421) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylidene-[2-(dimethylamino)ethylamino]methanol.
| Compound Name | cyclopenta-2,4-dien-1-ylidene-[2-(dimethylamino)ethylamino]methanol |
|---|---|
| PubChem CID | 166065421 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylidene-[2-(dimethylamino)ethylamino]methanol |
| SMILES | CN(C)CCNC(O)=C1C=CC=C1 |
| InChI | InChI=1S/C10H16N2O/c1-12(2)8-7-11-10(13)9-5-3-4-6-9/h3-6,11,13H,7-8H2,1-2H3 |
| InChIKey | UXWSPHIPTKRCPP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|