C34H29N3 — CID 144856610
(E)-cyclohexa-2,4-dien-1-ylidene-[4-[(Z)-hydrazinyl-(6-phenanthren-9-ylcyclohexa-2,4-dien-1-ylidene)methyl]phenyl]methanamine (PubChem CID 144856610) has the molecular formula C34H29N3 and a molecular weight of 479.63 g/mol. Its IUPAC name is (E)-cyclohexa-2,4-dien-1-ylidene-[4-[(Z)-hydrazinyl-(6-phenanthren-9-ylcyclohexa-2,4-dien-1-ylidene)methyl]phenyl]methanamine.
| Compound Name | (E)-cyclohexa-2,4-dien-1-ylidene-[4-[(Z)-hydrazinyl-(6-phenanthren-9-ylcyclohexa-2,4-dien-1-ylidene)methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 144856610 |
| Molecular Formula | C34H29N3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | (E)-cyclohexa-2,4-dien-1-ylidene-[4-[(Z)-hydrazinyl-(6-phenanthren-9-ylcyclohexa-2,4-dien-1-ylidene)methyl]phenyl]methanamine |
| SMILES | NN/C(=C1/C=CC=CC1c1cc2ccccc2c2ccccc12)c1ccc(/C(N)=C2\C=CC=CC2)cc1 |
| InChI | InChI=1S/C34H29N3/c35-33(23-10-2-1-3-11-23)24-18-20-25(21-19-24)34(37-36)31-17-9-8-16-30(31)32-22-26-12-4-5-13-27(26)28-14-6-7-15-29(28)32/h1-10,12-22,30,37H,11,35-36H2/b33-23-,34-31- |
| InChIKey | QKFCBTITLYFLIE-NOAQBEMQSA-N |
| XLogP | 7.26 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|