C14H24FN — CID 144859662
4-[(E)-but-2-en-2-yl]-1-(3-fluoro-3-methylbut-1-en-2-yl)piperidine (PubChem CID 144859662) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is 4-[(E)-but-2-en-2-yl]-1-(3-fluoro-3-methylbut-1-en-2-yl)piperidine.
| Compound Name | 4-[(E)-but-2-en-2-yl]-1-(3-fluoro-3-methylbut-1-en-2-yl)piperidine |
|---|---|
| PubChem CID | 144859662 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 4-[(E)-but-2-en-2-yl]-1-(3-fluoro-3-methylbut-1-en-2-yl)piperidine |
| SMILES | C=C(N1CCC(/C(C)=C/C)CC1)C(C)(C)F |
| InChI | InChI=1S/C14H24FN/c1-6-11(2)13-7-9-16(10-8-13)12(3)14(4,5)15/h6,13H,3,7-10H2,1-2,4-5H3/b11-6+ |
| InChIKey | HTFHLGAGKLKUSW-IZZDOVSWSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|