About 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one
3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one (PubChem CID 144870140) has the molecular formula C20H32FNO3
and a molecular weight of 353.48 g/mol. Its IUPAC name is 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one |
| PubChem CID | 144870140 |
| Molecular Formula | C20H32FNO3 |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one |
| SMILES | CC.CN1Cc2cc(F)c(O)cc2C1=O.OCCCC1CCCCC1 |
| InChI | InChI=1S/C9H8FNO2.C9H18O.C2H6/c1-11-4-5-2-7(10)8(12)3-6(5)9(11)13;10-8-4-7-9-5-2-1-3-6-9;1-2/h2-3,12H,4H2,1H3;9-10H,1-8H2;1-2H3 |
| InChIKey | NVCGQQMDBGTXFO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one?
The IUPAC name of 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one (CID 144870140) is 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one.
What is the SMILES notation for 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one?
The canonical SMILES for 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one is CC.CN1Cc2cc(F)c(O)cc2C1=O.OCCCC1CCCCC1.
What is the InChIKey of 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one?
The InChIKey is NVCGQQMDBGTXFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2.C9H18O.C2H6/c1-11-4-5-2-7(10)8(12)3-6(5)9(11)13;10-8-4-7-9-5-2-1-3-6-9;1-2/h2-3,12H,4H2,1H3;9-10H,1-8H2;1-2H3.
What are the key properties of 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one?
3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one has a molecular weight of 353.48 g/mol, XLogP of 4.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpropan-1-ol;ethane;5-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one is sourced from PubChem (CID 144870140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).