C29H44N2O9 — CID 144877354
butane;(3S)-7-cyclohexa-1,5-dien-1-yloxy-9-methyl-3-(methylamino)-1,5-dioxonan-2-one;(2-formyl-4-methoxy-3-pyridinyl)oxymethyl acetate (PubChem CID 144877354) has the molecular formula C29H44N2O9 and a molecular weight of 564.68 g/mol. Its IUPAC name is butane;(3S)-7-cyclohexa-1,5-dien-1-yloxy-9-methyl-3-(methylamino)-1,5-dioxonan-2-one;(2-formyl-4-methoxy-3-pyridinyl)oxymethyl acetate.
| Compound Name | butane;(3S)-7-cyclohexa-1,5-dien-1-yloxy-9-methyl-3-(methylamino)-1,5-dioxonan-2-one;(2-formyl-4-methoxy-3-pyridinyl)oxymethyl acetate |
|---|---|
| PubChem CID | 144877354 |
| Molecular Formula | C29H44N2O9 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | butane;(3S)-7-cyclohexa-1,5-dien-1-yloxy-9-methyl-3-(methylamino)-1,5-dioxonan-2-one;(2-formyl-4-methoxy-3-pyridinyl)oxymethyl acetate |
| SMILES | CCCC.CN[C@H]1COCC(OC2=CCCC=C2)CC(C)OC1=O.COc1ccnc(C=O)c1OCOC(C)=O |
| InChI | InChI=1S/C15H23NO4.C10H11NO5.C4H10/c1-11-8-13(20-12-6-4-3-5-7-12)9-18-10-14(16-2)15(17)19-11;1-7(13)15-6-16-10-8(5-12)11-4-3-9(10)14-2;1-3-4-2/h4,6-7,11,13-14,16H,3,5,8-10H2,1-2H3;3-5H,6H2,1-2H3;3-4H2,1-2H3/t11?,13?,14-;;/m0../s1 |
| InChIKey | SLQHVHIUXGBKQX-XTUXLZJWSA-N |
| XLogP | 4.15 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|