C29H44N2O8 — CID 144995988
(2-formyl-4-methoxy-3-pyridinyl)oxymethyl acetate;(3Z)-3-methylhexa-1,3,5-triene;(7S)-4-methyl-7-(methylamino)-2-propyl-1,5-dioxonan-6-one (PubChem CID 144995988) has the molecular formula C29H44N2O8 and a molecular weight of 548.68 g/mol. Its IUPAC name is (2-formyl-4-methoxy-3-pyridinyl)oxymethyl acetate;(3Z)-3-methylhexa-1,3,5-triene;(7S)-4-methyl-7-(methylamino)-2-propyl-1,5-dioxonan-6-one.
| Compound Name | (2-formyl-4-methoxy-3-pyridinyl)oxymethyl acetate;(3Z)-3-methylhexa-1,3,5-triene;(7S)-4-methyl-7-(methylamino)-2-propyl-1,5-dioxonan-6-one |
|---|---|
| PubChem CID | 144995988 |
| Molecular Formula | C29H44N2O8 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | (2-formyl-4-methoxy-3-pyridinyl)oxymethyl acetate;(3Z)-3-methylhexa-1,3,5-triene;(7S)-4-methyl-7-(methylamino)-2-propyl-1,5-dioxonan-6-one |
| SMILES | C=C/C=C(/C)C=C.CCCC1CC(C)OC(=O)[C@@H](NC)CCO1.COc1ccnc(C=O)c1OCOC(C)=O |
| InChI | InChI=1S/C12H23NO3.C10H11NO5.C7H10/c1-4-5-10-8-9(2)16-12(14)11(13-3)6-7-15-10;1-7(13)15-6-16-10-8(5-12)11-4-3-9(10)14-2;1-4-6-7(3)5-2/h9-11,13H,4-8H2,1-3H3;3-5H,6H2,1-2H3;4-6H,1-2H2,3H3/b;;7-6-/t9?,10?,11-;;/m0../s1 |
| InChIKey | QPEGZXGUOHGQRS-OVJQJIKJSA-N |
| XLogP | 4.59 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|