C14H19NO6 — CID 146594378
(2-formyl-4-methoxy-3-pyridinyl)oxymethyl 2-propoxypropanoate (PubChem CID 146594378) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2-formyl-4-methoxy-3-pyridinyl)oxymethyl 2-propoxypropanoate.
| Compound Name | (2-formyl-4-methoxy-3-pyridinyl)oxymethyl 2-propoxypropanoate |
|---|---|
| PubChem CID | 146594378 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (2-formyl-4-methoxy-3-pyridinyl)oxymethyl 2-propoxypropanoate |
| SMILES | CCCOC(C)C(=O)OCOc1c(OC)ccnc1C=O |
| InChI | InChI=1S/C14H19NO6/c1-4-7-19-10(2)14(17)21-9-20-13-11(8-16)15-6-5-12(13)18-3/h5-6,8,10H,4,7,9H2,1-3H3 |
| InChIKey | FELNSBFQRPABNF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|