C35H57N7O7 — CID 144887121
(2R)-4-[[2-[[(2S)-2-amino-3-[2-(decanoylamino)ethylamino]propanoyl]amino]acetyl]amino]-2-(5-oxopentanoylamino)butanoic acid;3-methyl-1H-indole (PubChem CID 144887121) has the molecular formula C35H57N7O7 and a molecular weight of 687.88 g/mol. Its IUPAC name is (2R)-4-[[2-[[(2S)-2-amino-3-[2-(decanoylamino)ethylamino]propanoyl]amino]acetyl]amino]-2-(5-oxopentanoylamino)butanoic acid;3-methyl-1H-indole.
| Compound Name | (2R)-4-[[2-[[(2S)-2-amino-3-[2-(decanoylamino)ethylamino]propanoyl]amino]acetyl]amino]-2-(5-oxopentanoylamino)butanoic acid;3-methyl-1H-indole |
|---|---|
| PubChem CID | 144887121 |
| Molecular Formula | C35H57N7O7 |
| Molecular Weight | 687.88 g/mol |
| Exact Mass | 687.43 |
| IUPAC Name | (2R)-4-[[2-[[(2S)-2-amino-3-[2-(decanoylamino)ethylamino]propanoyl]amino]acetyl]amino]-2-(5-oxopentanoylamino)butanoic acid;3-methyl-1H-indole |
| SMILES | CCCCCCCCCC(=O)NCCNC[C@H](N)C(=O)NCC(=O)NCC[C@@H](NC(=O)CCCC=O)C(=O)O.Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H48N6O7.C9H9N/c1-2-3-4-5-6-7-8-11-22(34)30-16-15-28-18-20(27)25(37)31-19-24(36)29-14-13-21(26(38)39)32-23(35)12-9-10-17-33;1-7-6-10-9-5-3-2-4-8(7)9/h17,20-21,28H,2-16,18-19,27H2,1H3,(H,29,36)(H,30,34)(H,31,37)(H,32,35)(H,38,39);2-6,10H,1H3/t20-,21+;/m0./s1 |
| InChIKey | UKEMRCYRDOXQLZ-JUDYQFGCSA-N |
| XLogP | 2.20 |
| TPSA | 224.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.88 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|