C14H18O2S — CID 14489896
1-[(1R,3R)-3-hydroxycyclohexyl]-2-phenylsulfanylethanone (PubChem CID 14489896) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-[(1R,3R)-3-hydroxycyclohexyl]-2-phenylsulfanylethanone.
| Compound Name | 1-[(1R,3R)-3-hydroxycyclohexyl]-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 14489896 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-[(1R,3R)-3-hydroxycyclohexyl]-2-phenylsulfanylethanone |
| SMILES | O=C(CSc1ccccc1)[C@@H]1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C14H18O2S/c15-12-6-4-5-11(9-12)14(16)10-17-13-7-2-1-3-8-13/h1-3,7-8,11-12,15H,4-6,9-10H2/t11-,12-/m1/s1 |
| InChIKey | BODRPEVGRAMTDM-VXGBXAGGSA-N |
| XLogP | 2.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |