C19H21NO6 — CID 144899639
7-methoxy-2-methylidene-4-(3,4,5-trimethoxyphenyl)-1,4-dihydro-3,1-benzoxazin-6-ol (PubChem CID 144899639) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 7-methoxy-2-methylidene-4-(3,4,5-trimethoxyphenyl)-1,4-dihydro-3,1-benzoxazin-6-ol.
| Compound Name | 7-methoxy-2-methylidene-4-(3,4,5-trimethoxyphenyl)-1,4-dihydro-3,1-benzoxazin-6-ol |
|---|---|
| PubChem CID | 144899639 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 7-methoxy-2-methylidene-4-(3,4,5-trimethoxyphenyl)-1,4-dihydro-3,1-benzoxazin-6-ol |
| SMILES | C=C1Nc2cc(OC)c(O)cc2C(c2cc(OC)c(OC)c(OC)c2)O1 |
| InChI | InChI=1S/C19H21NO6/c1-10-20-13-9-15(22-2)14(21)8-12(13)18(26-10)11-6-16(23-3)19(25-5)17(7-11)24-4/h6-9,18,20-21H,1H2,2-5H3 |
| InChIKey | LQXDVJOCITZVGU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|