C15H28INOS — CID 144921354
ethane;[1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite (PubChem CID 144921354) has the molecular formula C15H28INOS and a molecular weight of 397.37 g/mol. Its IUPAC name is ethane;[1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite.
| Compound Name | ethane;[1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite |
|---|---|
| PubChem CID | 144921354 |
| Molecular Formula | C15H28INOS |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | ethane;[1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite |
| SMILES | C/C=C\C(=C/C)CN1CC(COSI)CC1C.CC |
| InChI | InChI=1S/C13H22INOS.C2H6/c1-4-6-12(5-2)8-15-9-13(7-11(15)3)10-16-17-14;1-2/h4-6,11,13H,7-10H2,1-3H3;1-2H3/b6-4-,12-5+; |
| InChIKey | IYAJSEJHVAYRNC-QRGVYOGNSA-N |
| XLogP | 5.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|