C14H24INOS — CID 145005751
[1-[(Z,2E)-2-ethylidenehex-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite (PubChem CID 145005751) has the molecular formula C14H24INOS and a molecular weight of 381.32 g/mol. Its IUPAC name is [1-[(Z,2E)-2-ethylidenehex-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite.
| Compound Name | [1-[(Z,2E)-2-ethylidenehex-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite |
|---|---|
| PubChem CID | 145005751 |
| Molecular Formula | C14H24INOS |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [1-[(Z,2E)-2-ethylidenehex-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite |
| SMILES | C/C=C(\C=C/CC)CN1CC(COSI)CC1C |
| InChI | InChI=1S/C14H24INOS/c1-4-6-7-13(5-2)9-16-10-14(8-12(16)3)11-17-18-15/h5-7,12,14H,4,8-11H2,1-3H3/b7-6-,13-5+ |
| InChIKey | DKCYPPIFZIIYLI-ZQNRWWJISA-N |
| XLogP | 4.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|