C12H23NO — CID 164922622
(4S)-4-(methoxymethyl)-1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine (PubChem CID 164922622) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (4S)-4-(methoxymethyl)-1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine.
| Compound Name | (4S)-4-(methoxymethyl)-1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine |
|---|---|
| PubChem CID | 164922622 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (4S)-4-(methoxymethyl)-1-methyl-2-[(E)-3-methylbut-1-enyl]pyrrolidine |
| SMILES | COC[C@H]1CC(/C=C/C(C)C)N(C)C1 |
| InChI | InChI=1S/C12H23NO/c1-10(2)5-6-12-7-11(9-14-4)8-13(12)3/h5-6,10-12H,7-9H2,1-4H3/b6-5+/t11-,12?/m0/s1 |
| InChIKey | YLIIEODIZHCTSM-VSDTWRRPSA-N |
| XLogP | 2.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|