C13H20INOS — CID 145005620
[1-(cyclohexa-1,5-dien-1-ylmethyl)-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite (PubChem CID 145005620) has the molecular formula C13H20INOS and a molecular weight of 365.28 g/mol. Its IUPAC name is [1-(cyclohexa-1,5-dien-1-ylmethyl)-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite.
| Compound Name | [1-(cyclohexa-1,5-dien-1-ylmethyl)-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite |
|---|---|
| PubChem CID | 145005620 |
| Molecular Formula | C13H20INOS |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | [1-(cyclohexa-1,5-dien-1-ylmethyl)-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite |
| SMILES | CC1CC(COSI)CN1CC1=CCCC=C1 |
| InChI | InChI=1S/C13H20INOS/c1-11-7-13(10-16-17-14)9-15(11)8-12-5-3-2-4-6-12/h3,5-6,11,13H,2,4,7-10H2,1H3 |
| InChIKey | QVVQJSLUUGNPPW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|