C13H25NO — CID 171590790
(4R)-2-[(E)-3,3-dimethylbut-1-enyl]-4-(methoxymethyl)-1-methylpyrrolidine (PubChem CID 171590790) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (4R)-2-[(E)-3,3-dimethylbut-1-enyl]-4-(methoxymethyl)-1-methylpyrrolidine.
| Compound Name | (4R)-2-[(E)-3,3-dimethylbut-1-enyl]-4-(methoxymethyl)-1-methylpyrrolidine |
|---|---|
| PubChem CID | 171590790 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (4R)-2-[(E)-3,3-dimethylbut-1-enyl]-4-(methoxymethyl)-1-methylpyrrolidine |
| SMILES | COC[C@@H]1CC(/C=C/C(C)(C)C)N(C)C1 |
| InChI | InChI=1S/C13H25NO/c1-13(2,3)7-6-12-8-11(10-15-5)9-14(12)4/h6-7,11-12H,8-10H2,1-5H3/b7-6+/t11-,12?/m1/s1 |
| InChIKey | DGKOAHUJKLUNAV-GNHKTISMSA-N |
| XLogP | 2.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|