C29H36N4O5 — CID 144926427
[2-methyl-4-[pentyl(propyl)amino]phenyl] N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate (PubChem CID 144926427) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is [2-methyl-4-[pentyl(propyl)amino]phenyl] N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate.
| Compound Name | [2-methyl-4-[pentyl(propyl)amino]phenyl] N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate |
|---|---|
| PubChem CID | 144926427 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [2-methyl-4-[pentyl(propyl)amino]phenyl] N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate |
| SMILES | CCCCCN(CCC)c1ccc(OC(=O)Nc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)c(C)c1 |
| InChI | InChI=1S/C29H36N4O5/c1-4-6-7-16-32(15-5-2)20-11-13-25(19(3)17-20)38-29(37)30-23-10-8-9-21-22(23)18-33(28(21)36)24-12-14-26(34)31-27(24)35/h8-11,13,17,24H,4-7,12,14-16,18H2,1-3H3,(H,30,37)(H,31,34,35) |
| InChIKey | DPHVWMISSSUUOC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|