C14H21N — CID 144928932
ethane;N-(7-ethenyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methanimine (PubChem CID 144928932) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;N-(7-ethenyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methanimine.
| Compound Name | ethane;N-(7-ethenyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methanimine |
|---|---|
| PubChem CID | 144928932 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;N-(7-ethenyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methanimine |
| SMILES | C=CC1=CC=CC(C)(C)C=C1N=C.CC |
| InChI | InChI=1S/C12H15N.C2H6/c1-5-10-7-6-8-12(2,3)9-11(10)13-4;1-2/h5-9H,1,4H2,2-3H3;1-2H3 |
| InChIKey | JATCHSRMPXQITR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|