C19H34 — CID 144942492
ethane;(E,5E)-6-propan-2-ylidene-5-prop-2-enylideneundec-2-ene (PubChem CID 144942492) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is ethane;(E,5E)-6-propan-2-ylidene-5-prop-2-enylideneundec-2-ene.
| Compound Name | ethane;(E,5E)-6-propan-2-ylidene-5-prop-2-enylideneundec-2-ene |
|---|---|
| PubChem CID | 144942492 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | ethane;(E,5E)-6-propan-2-ylidene-5-prop-2-enylideneundec-2-ene |
| SMILES | C=C/C=C(\C/C=C/C)C(CCCCC)=C(C)C.CC |
| InChI | InChI=1S/C17H28.C2H6/c1-6-9-11-14-17(15(4)5)16(12-8-3)13-10-7-2;1-2/h7-8,10,12H,3,6,9,11,13-14H2,1-2,4-5H3;1-2H3/b10-7+,16-12+; |
| InChIKey | MOIOUMBOTVAETM-KRPVEDAVSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|