C10H14FN — CID 144950409
2-ethyl-N-methylcyclohexa-1,3-diene-1-carboximidoyl fluoride (PubChem CID 144950409) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 2-ethyl-N-methylcyclohexa-1,3-diene-1-carboximidoyl fluoride.
| Compound Name | 2-ethyl-N-methylcyclohexa-1,3-diene-1-carboximidoyl fluoride |
|---|---|
| PubChem CID | 144950409 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-ethyl-N-methylcyclohexa-1,3-diene-1-carboximidoyl fluoride |
| SMILES | CCC1=C(/C(F)=N/C)CCC=C1 |
| InChI | InChI=1S/C10H14FN/c1-3-8-6-4-5-7-9(8)10(11)12-2/h4,6H,3,5,7H2,1-2H3/b12-10- |
| InChIKey | AJVOXWWHTPWPBD-BENRWUELSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|