C19H22N4O2S — CID 144959679
tert-butyl 6-(1-cyanoisoquinolin-6-yl)-4-methyl-1,2,6-thiadiazinane-2-carboxylate (PubChem CID 144959679) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is tert-butyl 6-(1-cyanoisoquinolin-6-yl)-4-methyl-1,2,6-thiadiazinane-2-carboxylate.
| Compound Name | tert-butyl 6-(1-cyanoisoquinolin-6-yl)-4-methyl-1,2,6-thiadiazinane-2-carboxylate |
|---|---|
| PubChem CID | 144959679 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | tert-butyl 6-(1-cyanoisoquinolin-6-yl)-4-methyl-1,2,6-thiadiazinane-2-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)SN(c2ccc3c(C#N)nccc3c2)C1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13-11-22(26-23(12-13)18(24)25-19(2,3)4)15-5-6-16-14(9-15)7-8-21-17(16)10-20/h5-9,13H,11-12H2,1-4H3 |
| InChIKey | RKJUTGAMNQDHNX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|