C34H31BrN4 — CID 144976463
5-bromo-3-[(1Z)-buta-1,3-dienyl]-1-[4-[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]phenyl]-2-methylindole (PubChem CID 144976463) has the molecular formula C34H31BrN4 and a molecular weight of 575.55 g/mol. Its IUPAC name is 5-bromo-3-[(1Z)-buta-1,3-dienyl]-1-[4-[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]phenyl]-2-methylindole.
| Compound Name | 5-bromo-3-[(1Z)-buta-1,3-dienyl]-1-[4-[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]phenyl]-2-methylindole |
|---|---|
| PubChem CID | 144976463 |
| Molecular Formula | C34H31BrN4 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 5-bromo-3-[(1Z)-buta-1,3-dienyl]-1-[4-[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]phenyl]-2-methylindole |
| SMILES | C=C/C=C\c1c(C)n(-c2ccc(C3=NC(c4ccccc4)N=C(C(/C=C\C)=C/C)N3)cc2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C34H31BrN4/c1-5-8-15-29-23(4)39(31-21-18-27(35)22-30(29)31)28-19-16-26(17-20-28)34-37-32(24(7-3)12-6-2)36-33(38-34)25-13-10-9-11-14-25/h5-22,33H,1H2,2-4H3,(H,36,37,38)/b12-6-,15-8-,24-7+ |
| InChIKey | ITXHGXKGKBRAET-FJGYQYHFSA-N |
| XLogP | 8.87 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|