C25H32N2O4P2 — CID 144987411
2-[[2-[bis(dimethylamino)phosphanyl]phenyl]-(2,4-dimethoxyphenyl)phosphanyl]-5-methoxyphenol (PubChem CID 144987411) has the molecular formula C25H32N2O4P2 and a molecular weight of 486.49 g/mol. Its IUPAC name is 2-[[2-[bis(dimethylamino)phosphanyl]phenyl]-(2,4-dimethoxyphenyl)phosphanyl]-5-methoxyphenol.
| Compound Name | 2-[[2-[bis(dimethylamino)phosphanyl]phenyl]-(2,4-dimethoxyphenyl)phosphanyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 144987411 |
| Molecular Formula | C25H32N2O4P2 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-[[2-[bis(dimethylamino)phosphanyl]phenyl]-(2,4-dimethoxyphenyl)phosphanyl]-5-methoxyphenol |
| SMILES | COc1ccc(P(c2ccc(OC)cc2OC)c2ccccc2P(N(C)C)N(C)C)c(O)c1 |
| InChI | InChI=1S/C25H32N2O4P2/c1-26(2)33(27(3)4)25-11-9-8-10-24(25)32(22-14-12-18(29-5)16-20(22)28)23-15-13-19(30-6)17-21(23)31-7/h8-17,28H,1-7H3 |
| InChIKey | ILNXHZSOYMCSHP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|