C22H22O7PS- — CID 91579705
[2-bis(2,4-dimethoxyphenyl)phosphanylphenyl] sulfite (PubChem CID 91579705) has the molecular formula C22H22O7PS- and a molecular weight of 461.45 g/mol. Its IUPAC name is [2-bis(2,4-dimethoxyphenyl)phosphanylphenyl] sulfite.
| Compound Name | [2-bis(2,4-dimethoxyphenyl)phosphanylphenyl] sulfite |
|---|---|
| PubChem CID | 91579705 |
| Molecular Formula | C22H22O7PS- |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | [2-bis(2,4-dimethoxyphenyl)phosphanylphenyl] sulfite |
| SMILES | COc1ccc(P(c2ccc(OC)cc2OC)c2ccccc2OS(=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C22H23O7PS/c1-25-15-9-11-21(18(13-15)27-3)30(20-8-6-5-7-17(20)29-31(23)24)22-12-10-16(26-2)14-19(22)28-4/h5-14H,1-4H3,(H,23,24)/p-1 |
| InChIKey | QGHCABDNMKWQOV-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|