About CID 157372907
CID 157372907 (PubChem CID 157372907) has the molecular formula C52H69BN4O10P4
and a molecular weight of 1044.85 g/mol.
Molecular Properties
| Compound Name | CID 157372907 |
| PubChem CID | 157372907 |
| Molecular Formula | C52H69BN4O10P4 |
| Molecular Weight | 1044.85 g/mol |
| Exact Mass | 1044.41 |
| IUPAC Name | — |
| SMILES | CN(C)P(=O)(c1ccccc1)N(C)C.COc1ccc(P(c2ccc(OC)cc2OC)c2ccccc2P(=O)(N(C)C)N(C)C)c(OC)c1.[B]P(c1ccc(OC)cc1OC)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C26H34N2O5P2.C16H18BO4P.C10H17N2OP/c1-27(2)35(29,28(3)4)26-12-10-9-11-25(26)34(23-15-13-19(30-5)17-21(23)32-7)24-16-14-20(31-6)18-22(24)33-8;1-18-11-5-7-15(13(9-11)20-3)22(17)16-8-6-12(19-2)10-14(16)21-4;1-11(2)14(13,12(3)4)10-8-6-5-7-9-10/h9-18H,1-8H3;5-10H,1-4H3;5-9H,1-4H3 |
| InChIKey | YWJMIXOJSANHNQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1044.85 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 157372907 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157372907?
The IUPAC name of CID 157372907 (CID 157372907) is not available.
What is the SMILES notation for CID 157372907?
The canonical SMILES for CID 157372907 is CN(C)P(=O)(c1ccccc1)N(C)C.COc1ccc(P(c2ccc(OC)cc2OC)c2ccccc2P(=O)(N(C)C)N(C)C)c(OC)c1.[B]P(c1ccc(OC)cc1OC)c1ccc(OC)cc1OC.
What is the InChIKey of CID 157372907?
The InChIKey is YWJMIXOJSANHNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34N2O5P2.C16H18BO4P.C10H17N2OP/c1-27(2)35(29,28(3)4)26-12-10-9-11-25(26)34(23-15-13-19(30-5)17-21(23)32-7)24-16-14-20(31-6)18-22(24)33-8;1-18-11-5-7-15(13(9-11)20-3)22(17)16-8-6-12(19-2)10-14(16)21-4;1-11(2)14(13,12(3)4)10-8-6-5-7-9-10/h9-18H,1-8H3;5-10H,1-4H3;5-9H,1-4H3.
What are the key properties of CID 157372907?
CID 157372907 has a molecular weight of 1044.85 g/mol, XLogP of 7.29, 19 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157372907 is sourced from PubChem (CID 157372907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).