C56H40N4 — CID 144989867
6-[3-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-5-(3-phenanthren-9-ylcyclohexa-2,4-dien-1-yl)phenyl]phenyl]quinoline (PubChem CID 144989867) has the molecular formula C56H40N4 and a molecular weight of 768.96 g/mol. Its IUPAC name is 6-[3-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-5-(3-phenanthren-9-ylcyclohexa-2,4-dien-1-yl)phenyl]phenyl]quinoline.
| Compound Name | 6-[3-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-5-(3-phenanthren-9-ylcyclohexa-2,4-dien-1-yl)phenyl]phenyl]quinoline |
|---|---|
| PubChem CID | 144989867 |
| Molecular Formula | C56H40N4 |
| Molecular Weight | 768.96 g/mol |
| Exact Mass | 768.33 |
| IUPAC Name | 6-[3-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-5-(3-phenanthren-9-ylcyclohexa-2,4-dien-1-yl)phenyl]phenyl]quinoline |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2cc(-c3cccc(-c4ccc5ncccc5c4)c3)cc(C3C=C(c4cc5ccccc5c5ccccc45)C=CC3)c2)n1 |
| InChI | InChI=1S/C56H40N4/c1-3-15-37(4-2)54-58-55(38-16-6-5-7-17-38)60-56(59-54)48-34-46(40-20-12-19-39(30-40)42-27-28-53-45(32-42)23-14-29-57-53)33-47(35-48)41-21-13-22-43(31-41)52-36-44-18-8-9-24-49(44)50-25-10-11-26-51(50)52/h3-20,22-36,41H,1-2,21H2/b37-15+ |
| InChIKey | CZSFYANYAYCFRK-NOPDUFPGSA-N |
| XLogP | 14.28 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.96 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|