C25H25ClN4O2S3 — CID 144991596
[4-[[3-(2-aminosulfanyloxyethenyl)cyclopentyl]amino]pyrimidin-5-yl]-[4-(7-chloro-3,4-dihydro-1H-isothiochromen-1-yl)thiophen-2-yl]methanone (PubChem CID 144991596) has the molecular formula C25H25ClN4O2S3 and a molecular weight of 545.16 g/mol. Its IUPAC name is [4-[[3-(2-aminosulfanyloxyethenyl)cyclopentyl]amino]pyrimidin-5-yl]-[4-(7-chloro-3,4-dihydro-1H-isothiochromen-1-yl)thiophen-2-yl]methanone.
| Compound Name | [4-[[3-(2-aminosulfanyloxyethenyl)cyclopentyl]amino]pyrimidin-5-yl]-[4-(7-chloro-3,4-dihydro-1H-isothiochromen-1-yl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 144991596 |
| Molecular Formula | C25H25ClN4O2S3 |
| Molecular Weight | 545.16 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | [4-[[3-(2-aminosulfanyloxyethenyl)cyclopentyl]amino]pyrimidin-5-yl]-[4-(7-chloro-3,4-dihydro-1H-isothiochromen-1-yl)thiophen-2-yl]methanone |
| SMILES | NSOC=CC1CCC(Nc2ncncc2C(=O)c2cc(C3SCCc4ccc(Cl)cc43)cs2)C1 |
| InChI | InChI=1S/C25H25ClN4O2S3/c26-18-3-2-16-6-8-33-24(20(16)11-18)17-10-22(34-13-17)23(31)21-12-28-14-29-25(21)30-19-4-1-15(9-19)5-7-32-35-27/h2-3,5,7,10-15,19,24H,1,4,6,8-9,27H2,(H,28,29,30) |
| InChIKey | LVSCWRHWMXFTGU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.16 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|