C16H25N — CID 145015428
(3E,5Z)-2-butyl-3-ethenyl-2-propylhepta-3,5-dienenitrile (PubChem CID 145015428) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (3E,5Z)-2-butyl-3-ethenyl-2-propylhepta-3,5-dienenitrile.
| Compound Name | (3E,5Z)-2-butyl-3-ethenyl-2-propylhepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 145015428 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (3E,5Z)-2-butyl-3-ethenyl-2-propylhepta-3,5-dienenitrile |
| SMILES | C=C/C(=C\C=C/C)C(C#N)(CCC)CCCC |
| InChI | InChI=1S/C16H25N/c1-5-9-11-15(8-4)16(14-17,12-7-3)13-10-6-2/h5,8-9,11H,4,6-7,10,12-13H2,1-3H3/b9-5-,15-11+ |
| InChIKey | UWGAVLDXMPNTDW-QXJCPRNYSA-N |
| XLogP | 5.18 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|