C21H19F7N6O3S — CID 145015845
N-[3-[(5S)-2-amino-5-[formyl(2,2,2-trifluoroethyl)amino]-6-methyl-5,6-dihydro-4H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 145015845) has the molecular formula C21H19F7N6O3S and a molecular weight of 568.48 g/mol. Its IUPAC name is N-[3-[(5S)-2-amino-5-[formyl(2,2,2-trifluoroethyl)amino]-6-methyl-5,6-dihydro-4H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(5S)-2-amino-5-[formyl(2,2,2-trifluoroethyl)amino]-6-methyl-5,6-dihydro-4H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 145015845 |
| Molecular Formula | C21H19F7N6O3S |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | N-[3-[(5S)-2-amino-5-[formyl(2,2,2-trifluoroethyl)amino]-6-methyl-5,6-dihydro-4H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | CC1SC(N)=NC(c2cc(NC(=O)c3cnc(OCC(F)(F)F)cn3)ccc2F)[C@@H]1N(C=O)CC(F)(F)F |
| InChI | InChI=1S/C21H19F7N6O3S/c1-10-17(34(9-35)7-20(23,24)25)16(33-19(29)38-10)12-4-11(2-3-13(12)22)32-18(36)14-5-31-15(6-30-14)37-8-21(26,27)28/h2-6,9-10,16-17H,7-8H2,1H3,(H2,29,33)(H,32,36)/t10?,16?,17-/m1/s1 |
| InChIKey | HFYPEDBCJAQGTJ-LICNNDGESA-N |
| XLogP | 3.69 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|