C27H33N — CID 145021286
(1Z,3Z,6Z)-N-[[2-ethenyl-1,1,6-trimethyl-3-[(Z)-prop-1-enyl]inden-5-yl]methyl]-5-methylideneocta-1,3,6-trien-1-amine (PubChem CID 145021286) has the molecular formula C27H33N and a molecular weight of 371.57 g/mol. Its IUPAC name is (1Z,3Z,6Z)-N-[[2-ethenyl-1,1,6-trimethyl-3-[(Z)-prop-1-enyl]inden-5-yl]methyl]-5-methylideneocta-1,3,6-trien-1-amine.
| Compound Name | (1Z,3Z,6Z)-N-[[2-ethenyl-1,1,6-trimethyl-3-[(Z)-prop-1-enyl]inden-5-yl]methyl]-5-methylideneocta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 145021286 |
| Molecular Formula | C27H33N |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | (1Z,3Z,6Z)-N-[[2-ethenyl-1,1,6-trimethyl-3-[(Z)-prop-1-enyl]inden-5-yl]methyl]-5-methylideneocta-1,3,6-trien-1-amine |
| SMILES | C=CC1=C(/C=C\C)c2cc(CN/C=C\C=C/C(=C)/C=C\C)c(C)cc2C1(C)C |
| InChI | InChI=1S/C27H33N/c1-8-13-20(4)15-11-12-16-28-19-22-18-24-23(14-9-2)25(10-3)27(6,7)26(24)17-21(22)5/h8-18,28H,3-4,19H2,1-2,5-7H3/b13-8-,14-9-,15-11-,16-12- |
| InChIKey | YXNKRKRSQGZJLQ-YDNYZWCTSA-N |
| XLogP | 7.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|