C19H24NO2P — CID 145024452
3-(2-diphenylphosphanylethyl)-1,3-oxazolidin-2-one;ethane (PubChem CID 145024452) has the molecular formula C19H24NO2P and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-(2-diphenylphosphanylethyl)-1,3-oxazolidin-2-one;ethane.
| Compound Name | 3-(2-diphenylphosphanylethyl)-1,3-oxazolidin-2-one;ethane |
|---|---|
| PubChem CID | 145024452 |
| Molecular Formula | C19H24NO2P |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-(2-diphenylphosphanylethyl)-1,3-oxazolidin-2-one;ethane |
| SMILES | CC.O=C1OCCN1CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18NO2P.C2H6/c19-17-18(11-13-20-17)12-14-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16;1-2/h1-10H,11-14H2;1-2H3 |
| InChIKey | NKEBJKNSPSEVCL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|