C12H10S2 — CID 145028304
1,3-bis(2-methylsulfanylethynyl)benzene (PubChem CID 145028304) has the molecular formula C12H10S2 and a molecular weight of 218.35 g/mol. Its IUPAC name is 1,3-bis(2-methylsulfanylethynyl)benzene.
| Compound Name | 1,3-bis(2-methylsulfanylethynyl)benzene |
|---|---|
| PubChem CID | 145028304 |
| Molecular Formula | C12H10S2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 1,3-bis(2-methylsulfanylethynyl)benzene |
| SMILES | CSC#Cc1cccc(C#CSC)c1 |
| InChI | InChI=1S/C12H10S2/c1-13-8-6-11-4-3-5-12(10-11)7-9-14-2/h3-5,10H,1-2H3 |
| InChIKey | QWFHAMWEPHIHSZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|