C31H34FN3 — CID 145034929
acetylene;(4Z,5E)-2-N-[(2E,4Z)-4-(4-fluorophenyl)-3-methylhepta-2,4,6-trien-2-yl]-4-(2-pyridin-3-ylprop-2-enylidene)hepta-1,5-diene-2,5-diamine (PubChem CID 145034929) has the molecular formula C31H34FN3 and a molecular weight of 467.63 g/mol. Its IUPAC name is acetylene;(4Z,5E)-2-N-[(2E,4Z)-4-(4-fluorophenyl)-3-methylhepta-2,4,6-trien-2-yl]-4-(2-pyridin-3-ylprop-2-enylidene)hepta-1,5-diene-2,5-diamine.
| Compound Name | acetylene;(4Z,5E)-2-N-[(2E,4Z)-4-(4-fluorophenyl)-3-methylhepta-2,4,6-trien-2-yl]-4-(2-pyridin-3-ylprop-2-enylidene)hepta-1,5-diene-2,5-diamine |
|---|---|
| PubChem CID | 145034929 |
| Molecular Formula | C31H34FN3 |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | acetylene;(4Z,5E)-2-N-[(2E,4Z)-4-(4-fluorophenyl)-3-methylhepta-2,4,6-trien-2-yl]-4-(2-pyridin-3-ylprop-2-enylidene)hepta-1,5-diene-2,5-diamine |
| SMILES | C#C.C=C/C=C(C(\C)=C(/C)NC(=C)CC(=C/C(=C)c1cccnc1)/C(N)=C\C)/c1ccc(F)cc1 |
| InChI | InChI=1S/C29H32FN3.C2H2/c1-7-10-28(24-12-14-27(30)15-13-24)22(5)23(6)33-21(4)18-26(29(31)8-2)17-20(3)25-11-9-16-32-19-25;1-2/h7-17,19,33H,1,3-4,18,31H2,2,5-6H3;1-2H/b23-22+,26-17-,28-10+,29-8+; |
| InChIKey | JVCVTXHQONCEJF-FPLHWCOBSA-N |
| XLogP | 7.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|