C9H4Cl3NaO2S — CID 145054488
sodium 2-sulfanyl-3-(2,3,6-trichlorophenyl)prop-2-enoate (PubChem CID 145054488) has the molecular formula C9H4Cl3NaO2S and a molecular weight of 305.55 g/mol. Its IUPAC name is sodium 2-sulfanyl-3-(2,3,6-trichlorophenyl)prop-2-enoate.
| Compound Name | sodium 2-sulfanyl-3-(2,3,6-trichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 145054488 |
| Molecular Formula | C9H4Cl3NaO2S |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 303.89 |
| IUPAC Name | sodium 2-sulfanyl-3-(2,3,6-trichlorophenyl)prop-2-enoate |
| SMILES | O=C([O-])C(S)=Cc1c(Cl)ccc(Cl)c1Cl.[Na+] |
| InChI | InChI=1S/C9H5Cl3O2S.Na/c10-5-1-2-6(11)8(12)4(5)3-7(15)9(13)14;/h1-3,15H,(H,13,14);/q;+1/p-1 |
| InChIKey | MSJUIUMLOZYHDP-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|