C34H38BNO2 — CID 145073128
9-(3-cyclohepta-1,3,6-trien-1-ylcyclohepta-1,4,6-trien-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;ethane (PubChem CID 145073128) has the molecular formula C34H38BNO2 and a molecular weight of 503.50 g/mol. Its IUPAC name is 9-(3-cyclohepta-1,3,6-trien-1-ylcyclohepta-1,4,6-trien-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;ethane.
| Compound Name | 9-(3-cyclohepta-1,3,6-trien-1-ylcyclohepta-1,4,6-trien-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;ethane |
|---|---|
| PubChem CID | 145073128 |
| Molecular Formula | C34H38BNO2 |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | 9-(3-cyclohepta-1,3,6-trien-1-ylcyclohepta-1,4,6-trien-1-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;ethane |
| SMILES | CC.CC1(C)OB(c2ccc3c(c2)c2ccccc2n3C2=CC(C3=CC=CCC=C3)C=CC=C2)OC1(C)C |
| InChI | InChI=1S/C32H32BNO2.C2H6/c1-31(2)32(3,4)36-33(35-31)25-19-20-30-28(22-25)27-17-11-12-18-29(27)34(30)26-16-10-9-15-24(21-26)23-13-7-5-6-8-14-23;1-2/h5,7-22,24H,6H2,1-4H3;1-2H3 |
| InChIKey | GZDYHQXMSWBYNG-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|