C29H26N2 — CID 145083133
2-N-[(3Z)-penta-1,3-dien-2-yl]-2-N-[3-(3-phenylphenyl)phenyl]benzene-1,2-diamine (PubChem CID 145083133) has the molecular formula C29H26N2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-N-[(3Z)-penta-1,3-dien-2-yl]-2-N-[3-(3-phenylphenyl)phenyl]benzene-1,2-diamine.
| Compound Name | 2-N-[(3Z)-penta-1,3-dien-2-yl]-2-N-[3-(3-phenylphenyl)phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 145083133 |
| Molecular Formula | C29H26N2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-N-[(3Z)-penta-1,3-dien-2-yl]-2-N-[3-(3-phenylphenyl)phenyl]benzene-1,2-diamine |
| SMILES | C=C(/C=C\C)N(c1cccc(-c2cccc(-c3ccccc3)c2)c1)c1ccccc1N |
| InChI | InChI=1S/C29H26N2/c1-3-11-22(2)31(29-19-8-7-18-28(29)30)27-17-10-16-26(21-27)25-15-9-14-24(20-25)23-12-5-4-6-13-23/h3-21H,2,30H2,1H3/b11-3- |
| InChIKey | WEYVUROMXKHQDD-JYOAFUTRSA-N |
| XLogP | 7.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|