C11H17N7 — CID 145083372
(9S)-N'-hydrazinyl-8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboximidamide (PubChem CID 145083372) has the molecular formula C11H17N7 and a molecular weight of 247.31 g/mol. Its IUPAC name is (9S)-N'-hydrazinyl-8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboximidamide.
| Compound Name | (9S)-N'-hydrazinyl-8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboximidamide |
|---|---|
| PubChem CID | 145083372 |
| Molecular Formula | C11H17N7 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (9S)-N'-hydrazinyl-8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboximidamide |
| SMILES | CN1c2nc(/C(N)=N/NN)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C11H17N7/c1-17-7-4-5-18(6-7)9-3-2-8(14-11(9)17)10(12)15-16-13/h2-3,7,16H,4-6,13H2,1H3,(H2,12,15)/t7-/m0/s1 |
| InChIKey | XHJXBQCAWUIJJI-ZETCQYMHSA-N |
| XLogP | -0.81 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|