C21H27FN4O3 — CID 145084126
acetaldehyde;5-fluoro-2-propan-2-ylpyridine;8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid (PubChem CID 145084126) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is acetaldehyde;5-fluoro-2-propan-2-ylpyridine;8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid.
| Compound Name | acetaldehyde;5-fluoro-2-propan-2-ylpyridine;8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 145084126 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | acetaldehyde;5-fluoro-2-propan-2-ylpyridine;8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylic acid |
| SMILES | CC(C)c1ccc(F)cn1.CC=O.CN1c2nc(C(=O)O)ccc2N2CCC1C2 |
| InChI | InChI=1S/C11H13N3O2.C8H10FN.C2H4O/c1-13-7-4-5-14(6-7)9-3-2-8(11(15)16)12-10(9)13;1-6(2)8-4-3-7(9)5-10-8;1-2-3/h2-3,7H,4-6H2,1H3,(H,15,16);3-6H,1-2H3;2H,1H3 |
| InChIKey | KHNXMFPCWPNEQA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|